C15H27N5O2S — CID 135830716
1-[(2S)-butan-2-yl]-5-[(E)-[2-(diethylamino)ethylhydrazinylidene]methyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 135830716) has the molecular formula C15H27N5O2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-5-[(E)-[2-(diethylamino)ethylhydrazinylidene]methyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2S)-butan-2-yl]-5-[(E)-[2-(diethylamino)ethylhydrazinylidene]methyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135830716 |
| Molecular Formula | C15H27N5O2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-5-[(E)-[2-(diethylamino)ethylhydrazinylidene]methyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CC[C@H](C)n1c(O)c(/C=N/NCCN(CC)CC)c(=O)[nH]c1=S |
| InChI | InChI=1S/C15H27N5O2S/c1-5-11(4)20-14(22)12(13(21)18-15(20)23)10-17-16-8-9-19(6-2)7-3/h10-11,16,22H,5-9H2,1-4H3,(H,18,21,23)/b17-10+/t11-/m0/s1 |
| InChIKey | ZMVRVGKBZUTOLL-MUOOZZNISA-N |
| XLogP | 1.85 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|