About 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate
4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate (PubChem CID 135831248) has the molecular formula C19H12N3O6-
and a molecular weight of 378.32 g/mol. Its IUPAC name is 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate.
Molecular Properties
| Compound Name | 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate |
| PubChem CID | 135831248 |
| Molecular Formula | C19H12N3O6- |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate |
| SMILES | O=C(O)c1ccccc1/N=C/c1nc(/C=C/c2cccc([N+](=O)[O-])c2)oc1[O-] |
| InChI | InChI=1S/C19H13N3O6/c23-18(24)14-6-1-2-7-15(14)20-11-16-19(25)28-17(21-16)9-8-12-4-3-5-13(10-12)22(26)27/h1-11,25H,(H,23,24)/p-1/b9-8+,20-11+ |
| InChIKey | NOWRKTYVFZWNFR-XCUBKUTJSA-M |
| XLogP | 3.28 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate?
The IUPAC name of 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate (CID 135831248) is 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate.
What is the SMILES notation for 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate?
The canonical SMILES for 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate is O=C(O)c1ccccc1/N=C/c1nc(/C=C/c2cccc([N+](=O)[O-])c2)oc1[O-].
What is the InChIKey of 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate?
The InChIKey is NOWRKTYVFZWNFR-XCUBKUTJSA-M. The full InChI is InChI=1S/C19H13N3O6/c23-18(24)14-6-1-2-7-15(14)20-11-16-19(25)28-17(21-16)9-8-12-4-3-5-13(10-12)22(26)27/h1-11,25H,(H,23,24)/p-1/b9-8+,20-11+.
What are the key properties of 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate?
4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate has a molecular weight of 378.32 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate is sourced from PubChem (CID 135831248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).