About 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one
1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 135832631) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135832631 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(C)nc12 |
| InChI | InChI=1S/C10H14N4O/c1-4-5-7-8-9(14(3)13-7)10(15)12-6(2)11-8/h4-5H2,1-3H3,(H,11,12,15) |
| InChIKey | UHNSLPQFIBCBDW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CID 135832631) is 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is CCCc1nn(C)c2c(=O)[nH]c(C)nc12.
What is the InChIKey of 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is UHNSLPQFIBCBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-4-5-7-8-9(14(3)13-7)10(15)12-6(2)11-8/h4-5H2,1-3H3,(H,11,12,15).
What are the key properties of 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 206.25 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135832631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).