About 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one
1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 135832642) has the molecular formula C15H15N5O3
and a molecular weight of 313.32 g/mol. Its IUPAC name is 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135832642 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3ccccc3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C15H15N5O3/c1-3-6-10-12-13(19(2)18-10)15(21)17-14(16-12)9-7-4-5-8-11(9)20(22)23/h4-5,7-8H,3,6H2,1-2H3,(H,16,17,21) |
| InChIKey | YCUPRYDDWADPAJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CID 135832642) is 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is CCCc1nn(C)c2c(=O)[nH]c(-c3ccccc3[N+](=O)[O-])nc12.
What is the InChIKey of 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is YCUPRYDDWADPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O3/c1-3-6-10-12-13(19(2)18-10)15(21)17-14(16-12)9-7-4-5-8-11(9)20(22)23/h4-5,7-8H,3,6H2,1-2H3,(H,16,17,21).
What are the key properties of 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 313.32 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-(2-nitrophenyl)-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135832642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).