C25H29ClN2O2 — CID 135832991
(4Z)-2-(4-chlorophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 135832991) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is (4Z)-2-(4-chlorophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4Z)-2-(4-chlorophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 135832991 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (4Z)-2-(4-chlorophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2ccc(Cl)cc2)C(=O)/C1=C\c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H29ClN2O2/c1-15-19(23(30)28(27-15)18-10-8-17(26)9-11-18)12-16-13-20(24(2,3)4)22(29)21(14-16)25(5,6)7/h8-14,29H,1-7H3/b19-12- |
| InChIKey | RFOOBEHMOYKJDK-UNOMPAQXSA-N |
| XLogP | 6.45 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|