About 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one
5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one (PubChem CID 135833387) has the molecular formula C4H2BrN5O
and a molecular weight of 216.00 g/mol. Its IUPAC name is 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one.
Molecular Properties
| Compound Name | 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one |
| PubChem CID | 135833387 |
| Molecular Formula | C4H2BrN5O |
| Molecular Weight | 216.00 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one |
| SMILES | O=c1[nH]nnc2n[nH]c(Br)c12 |
| InChI | InChI=1S/C4H2BrN5O/c5-2-1-3(7-6-2)8-10-9-4(1)11/h(H2,6,7,8,9,11) |
| InChIKey | HYRNCRWAHSCTLR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.00 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one?
The IUPAC name of 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one (CID 135833387) is 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one.
What is the SMILES notation for 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one?
The canonical SMILES for 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one is O=c1[nH]nnc2n[nH]c(Br)c12.
What is the InChIKey of 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one?
The InChIKey is HYRNCRWAHSCTLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrN5O/c5-2-1-3(7-6-2)8-10-9-4(1)11/h(H2,6,7,8,9,11).
What are the key properties of 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one?
5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one has a molecular weight of 216.00 g/mol, XLogP of -0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,6-dihydropyrazolo[3,4-d]triazin-4-one is sourced from PubChem (CID 135833387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).