C10H14N4O2 — CID 135833894
2-methyl-7-propan-2-yl-3,5,7,8-tetrahydropteridine-4,6-dione (PubChem CID 135833894) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-methyl-7-propan-2-yl-3,5,7,8-tetrahydropteridine-4,6-dione.
| Compound Name | 2-methyl-7-propan-2-yl-3,5,7,8-tetrahydropteridine-4,6-dione |
|---|---|
| PubChem CID | 135833894 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-methyl-7-propan-2-yl-3,5,7,8-tetrahydropteridine-4,6-dione |
| SMILES | Cc1nc2c(c(=O)[nH]1)NC(=O)C(C(C)C)N2 |
| InChI | InChI=1S/C10H14N4O2/c1-4(2)6-9(15)14-7-8(13-6)11-5(3)12-10(7)16/h4,6H,1-3H3,(H,14,15)(H2,11,12,13,16) |
| InChIKey | HKVZIDVRYBFLRA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |