C24H19ClN2O3S — CID 135834372
(5Z)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-hydroxy-6-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135834372) has the molecular formula C24H19ClN2O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is (5Z)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-hydroxy-6-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-hydroxy-6-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135834372 |
| Molecular Formula | C24H19ClN2O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (5Z)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-hydroxy-6-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(O)c1/N=C1\NC(=O)/C(=C/c2ccccc2OCc2ccccc2Cl)S1 |
| InChI | InChI=1S/C24H19ClN2O3S/c1-15-7-6-11-19(28)22(15)26-24-27-23(29)21(31-24)13-16-8-3-5-12-20(16)30-14-17-9-2-4-10-18(17)25/h2-13,28H,14H2,1H3,(H,26,27,29)/b21-13- |
| InChIKey | XRMYULWBGQSHLK-BKUYFWCQSA-N |
| XLogP | 5.82 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|