C10H14N2O2 — CID 135837139
5-acetyl-2,4-diethyl-1H-pyrimidin-6-one (PubChem CID 135837139) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-acetyl-2,4-diethyl-1H-pyrimidin-6-one.
| Compound Name | 5-acetyl-2,4-diethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135837139 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5-acetyl-2,4-diethyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(CC)c(C(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N2O2/c1-4-7-9(6(3)13)10(14)12-8(5-2)11-7/h4-5H2,1-3H3,(H,11,12,14) |
| InChIKey | KDXNMVNGZBOTQX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |