C14H15N5O — CID 135837189
(3R,7S)-4,7-dimethyl-2-phenyl-6-oxa-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-4,9,11-triene (PubChem CID 135837189) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is (3R,7S)-4,7-dimethyl-2-phenyl-6-oxa-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-4,9,11-triene.
| Compound Name | (3R,7S)-4,7-dimethyl-2-phenyl-6-oxa-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-4,9,11-triene |
|---|---|
| PubChem CID | 135837189 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (3R,7S)-4,7-dimethyl-2-phenyl-6-oxa-1,5,8,10,12-pentazatricyclo[7.3.0.03,7]dodeca-4,9,11-triene |
| SMILES | CC1=NO[C@]2(C)Nc3ncnn3C(c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C14H15N5O/c1-9-11-12(10-6-4-3-5-7-10)19-13(15-8-16-19)17-14(11,2)20-18-9/h3-8,11-12H,1-2H3,(H,15,16,17)/t11-,12?,14-/m0/s1 |
| InChIKey | PSWUECBRCBEJAZ-PSIKVXPXSA-N |
| XLogP | 2.03 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |