C32H36N4O2 — CID 135837710
N,N-diethyl-2-hydroxy-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxamide (PubChem CID 135837710) has the molecular formula C32H36N4O2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N,N-diethyl-2-hydroxy-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxamide.
| Compound Name | N,N-diethyl-2-hydroxy-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 135837710 |
| Molecular Formula | C32H36N4O2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | N,N-diethyl-2-hydroxy-3-[C-phenyl-N-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(/C(=N/c3ccc(CN4CCCCC4)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C32H36N4O2/c1-3-36(4-2)32(38)25-15-18-27-28(21-25)34-31(37)29(27)30(24-11-7-5-8-12-24)33-26-16-13-23(14-17-26)22-35-19-9-6-10-20-35/h5,7-8,11-18,21,34,37H,3-4,6,9-10,19-20,22H2,1-2H3/b33-30+ |
| InChIKey | TULIKPTUEYEEAM-KKYHWDRJSA-N |
| XLogP | 6.51 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|