About methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate
methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate (PubChem CID 135837808) has the molecular formula C23H18N2O3
and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate |
| PubChem CID | 135837808 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(/C(=N/c3ccccc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C23H18N2O3/c1-28-23(27)16-12-13-18-19(14-16)25-22(26)20(18)21(15-8-4-2-5-9-15)24-17-10-6-3-7-11-17/h2-14,25-26H,1H3/b24-21+ |
| InChIKey | NDXXJERYEUGUNT-DARPEHSRSA-N |
| XLogP | 4.83 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate?
The IUPAC name of methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate (CID 135837808) is methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate.
What is the SMILES notation for methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate?
The canonical SMILES for methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate is COC(=O)c1ccc2c(/C(=N/c3ccccc3)c3ccccc3)c(O)[nH]c2c1.
What is the InChIKey of methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate?
The InChIKey is NDXXJERYEUGUNT-DARPEHSRSA-N. The full InChI is InChI=1S/C23H18N2O3/c1-28-23(27)16-12-13-18-19(14-16)25-22(26)20(18)21(15-8-4-2-5-9-15)24-17-10-6-3-7-11-17/h2-14,25-26H,1H3/b24-21+.
What are the key properties of methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate?
methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate has a molecular weight of 370.41 g/mol, XLogP of 4.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-6-carboxylate is sourced from PubChem (CID 135837808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).