About 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one
7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one (PubChem CID 135838133) has the molecular formula C13H11ClN2O
and a molecular weight of 246.70 g/mol. Its IUPAC name is 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one.
Molecular Properties
| Compound Name | 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one |
| PubChem CID | 135838133 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)-c1cccc(Cl)c1CC2 |
| InChI | InChI=1S/C13H11ClN2O/c1-7-15-11-6-5-8-9(3-2-4-10(8)14)12(11)13(17)16-7/h2-4H,5-6H2,1H3,(H,15,16,17) |
| InChIKey | SGWNSOQGMXHSSE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
The IUPAC name of 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one (CID 135838133) is 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one.
What is the SMILES notation for 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
The canonical SMILES for 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one is Cc1nc2c(c(=O)[nH]1)-c1cccc(Cl)c1CC2.
What is the InChIKey of 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
The InChIKey is SGWNSOQGMXHSSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O/c1-7-15-11-6-5-8-9(3-2-4-10(8)14)12(11)13(17)16-7/h2-4H,5-6H2,1H3,(H,15,16,17).
What are the key properties of 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one has a molecular weight of 246.70 g/mol, XLogP of 2.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-methyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one is sourced from PubChem (CID 135838133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).