About 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one
3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one (PubChem CID 135838222) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one.
Molecular Properties
| Compound Name | 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one |
| PubChem CID | 135838222 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one |
| SMILES | Cc1cc(C)c2c(c1)-c1c(nc(N)[nH]c1=O)CC2 |
| InChI | InChI=1S/C14H15N3O/c1-7-5-8(2)9-3-4-11-12(10(9)6-7)13(18)17-14(15)16-11/h5-6H,3-4H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | NFQSGQYZCZHRHW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
The IUPAC name of 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one (CID 135838222) is 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one.
What is the SMILES notation for 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
The canonical SMILES for 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one is Cc1cc(C)c2c(c1)-c1c(nc(N)[nH]c1=O)CC2.
What is the InChIKey of 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
The InChIKey is NFQSGQYZCZHRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c1-7-5-8(2)9-3-4-11-12(10(9)6-7)13(18)17-14(15)16-11/h5-6H,3-4H2,1-2H3,(H3,15,16,17,18).
What are the key properties of 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one?
3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one has a molecular weight of 241.29 g/mol, XLogP of 1.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7,9-dimethyl-5,6-dihydro-2H-benzo[f]quinazolin-1-one is sourced from PubChem (CID 135838222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).