C16H16ClN3O3 — CID 135839461
(2E)-N'-[(3-chloro-4-methoxyphenyl)methyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide (PubChem CID 135839461) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is (2E)-N'-[(3-chloro-4-methoxyphenyl)methyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide.
| Compound Name | (2E)-N'-[(3-chloro-4-methoxyphenyl)methyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
|---|---|
| PubChem CID | 135839461 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (2E)-N'-[(3-chloro-4-methoxyphenyl)methyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
| SMILES | COc1ccc(C/N=C(NO)/C(=N/O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H16ClN3O3/c1-23-14-8-7-11(9-13(14)17)10-18-16(20-22)15(19-21)12-5-3-2-4-6-12/h2-9,21-22H,10H2,1H3,(H,18,20)/b19-15+ |
| InChIKey | WNLIHSZEQUHGBH-XDJHFCHBSA-N |
| XLogP | 3.10 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|