C15H11ClN3O4S- — CID 135840093
4-chloro-3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzoate (PubChem CID 135840093) has the molecular formula C15H11ClN3O4S- and a molecular weight of 364.79 g/mol. Its IUPAC name is 4-chloro-3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzoate.
| Compound Name | 4-chloro-3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 135840093 |
| Molecular Formula | C15H11ClN3O4S- |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 4-chloro-3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]benzoate |
| SMILES | C=CCn1c(O)c(/C=N/c2cc(C(=O)[O-])ccc2Cl)c(=O)[nH]c1=S |
| InChI | InChI=1S/C15H12ClN3O4S/c1-2-5-19-13(21)9(12(20)18-15(19)24)7-17-11-6-8(14(22)23)3-4-10(11)16/h2-4,6-7,21H,1,5H2,(H,22,23)(H,18,20,24)/p-1/b17-7+ |
| InChIKey | PZPROSVHKCZISH-REZTVBANSA-M |
| XLogP | 1.56 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|