About propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate
propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate (PubChem CID 135840444) has the molecular formula C15H17N3O3S
and a molecular weight of 319.39 g/mol. Its IUPAC name is propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
| PubChem CID | 135840444 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
| SMILES | CCCOC(=O)CSc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H17N3O3S/c1-2-8-21-13(19)10-22-15-16-14(20)12(17-18-15)9-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,16,18,20) |
| InChIKey | SWRJXOPNLDQFQJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate?
The IUPAC name of propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate (CID 135840444) is propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate.
What is the SMILES notation for propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate?
The canonical SMILES for propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate is CCCOC(=O)CSc1nnc(Cc2ccccc2)c(=O)[nH]1.
What is the InChIKey of propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate?
The InChIKey is SWRJXOPNLDQFQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3S/c1-2-8-21-13(19)10-22-15-16-14(20)12(17-18-15)9-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,16,18,20).
What are the key properties of propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate?
propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate has a molecular weight of 319.39 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate is sourced from PubChem (CID 135840444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).