C19H14FN5O3S — CID 135840710
2-fluoro-N'-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 135840710) has the molecular formula C19H14FN5O3S and a molecular weight of 411.42 g/mol. Its IUPAC name is 2-fluoro-N'-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 135840710 |
| Molecular Formula | C19H14FN5O3S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-fluoro-N'-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc(-c2c[nH]c3ccccc23)o1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C19H14FN5O3S/c20-14-7-3-1-6-12(14)17(27)23-22-16(26)10-29-19-25-24-18(28-19)13-9-21-15-8-4-2-5-11(13)15/h1-9,21H,10H2,(H,22,26)(H,23,27) |
| InChIKey | OFHRIXALQWVTQS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|