C15H20BrN3S — CID 135840820
N-cyclohexyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide (PubChem CID 135840820) has the molecular formula C15H20BrN3S and a molecular weight of 354.32 g/mol. Its IUPAC name is N-cyclohexyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide.
| Compound Name | N-cyclohexyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide |
|---|---|
| PubChem CID | 135840820 |
| Molecular Formula | C15H20BrN3S |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-cyclohexyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide |
| SMILES | Br.c1ccc(C2=NN/C(=N/C3CCCCC3)SC2)cc1 |
| InChI | InChI=1S/C15H19N3S.BrH/c1-3-7-12(8-4-1)14-11-19-15(18-17-14)16-13-9-5-2-6-10-13;/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,16,18);1H |
| InChIKey | KFDNDBLXFQDITM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|