C15H13N3OS2 — CID 135841097
(5Z)-2-(4-methylphenyl)imino-5-[(2-methyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135841097) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (5Z)-2-(4-methylphenyl)imino-5-[(2-methyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-methylphenyl)imino-5-[(2-methyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135841097 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (5Z)-2-(4-methylphenyl)imino-5-[(2-methyl-1,3-thiazol-4-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3csc(C)n3)S2)cc1 |
| InChI | InChI=1S/C15H13N3OS2/c1-9-3-5-11(6-4-9)17-15-18-14(19)13(21-15)7-12-8-20-10(2)16-12/h3-8H,1-2H3,(H,17,18,19)/b13-7- |
| InChIKey | WKMUEJAPHRPJIL-QPEQYQDCSA-N |
| XLogP | 3.65 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|