About 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one
2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one (PubChem CID 135841333) has the molecular formula C15H15Cl2N5O2
and a molecular weight of 368.22 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one |
| PubChem CID | 135841333 |
| Molecular Formula | C15H15Cl2N5O2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one |
| SMILES | COCCn1cnc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C15H15Cl2N5O2/c1-24-5-4-22-8-19-13-12(22)14(23)21-15(20-13)18-7-9-2-3-10(16)11(17)6-9/h2-3,6,8H,4-5,7H2,1H3,(H2,18,20,21,23) |
| InChIKey | PZOWACKEDKUJLZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one?
The IUPAC name of 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one (CID 135841333) is 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one?
The canonical SMILES for 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one is COCCn1cnc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21.
What is the InChIKey of 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one?
The InChIKey is PZOWACKEDKUJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N5O2/c1-24-5-4-22-8-19-13-12(22)14(23)21-15(20-13)18-7-9-2-3-10(16)11(17)6-9/h2-3,6,8H,4-5,7H2,1H3,(H2,18,20,21,23).
What are the key properties of 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one?
2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one has a molecular weight of 368.22 g/mol, XLogP of 2.68, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)methylamino]-7-(2-methoxyethyl)-1H-purin-6-one is sourced from PubChem (CID 135841333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).