C28H18N2O3S — CID 135841603
3,6-bis(6-methyl-1,3-benzoxazol-2-yl)dibenzothiophen-2-ol (PubChem CID 135841603) has the molecular formula C28H18N2O3S and a molecular weight of 462.53 g/mol. Its IUPAC name is 3,6-bis(6-methyl-1,3-benzoxazol-2-yl)dibenzothiophen-2-ol.
| Compound Name | 3,6-bis(6-methyl-1,3-benzoxazol-2-yl)dibenzothiophen-2-ol |
|---|---|
| PubChem CID | 135841603 |
| Molecular Formula | C28H18N2O3S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3,6-bis(6-methyl-1,3-benzoxazol-2-yl)dibenzothiophen-2-ol |
| SMILES | Cc1ccc2nc(-c3cc4sc5c(-c6nc7ccc(C)cc7o6)cccc5c4cc3O)oc2c1 |
| InChI | InChI=1S/C28H18N2O3S/c1-14-6-8-20-23(10-14)32-27(29-20)17-5-3-4-16-18-12-22(31)19(13-25(18)34-26(16)17)28-30-21-9-7-15(2)11-24(21)33-28/h3-13,31H,1-2H3 |
| InChIKey | KIFSHCDJUUNZGW-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |