About 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol
4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol (PubChem CID 135842497) has the molecular formula C11H11N3O2S
and a molecular weight of 249.30 g/mol. Its IUPAC name is 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol |
| PubChem CID | 135842497 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol |
| SMILES | N/N=C(/Cc1cscn1)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H11N3O2S/c12-14-10(3-7-5-17-6-13-7)9-2-1-8(15)4-11(9)16/h1-2,4-6,15-16H,3,12H2/b14-10- |
| InChIKey | ZGSZQNACRIWTMG-UVTDQMKNSA-N |
| XLogP | 1.46 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol?
The IUPAC name of 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol (CID 135842497) is 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol.
What is the SMILES notation for 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol?
The canonical SMILES for 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol is N/N=C(/Cc1cscn1)c1ccc(O)cc1O.
What is the InChIKey of 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol?
The InChIKey is ZGSZQNACRIWTMG-UVTDQMKNSA-N. The full InChI is InChI=1S/C11H11N3O2S/c12-14-10(3-7-5-17-6-13-7)9-2-1-8(15)4-11(9)16/h1-2,4-6,15-16H,3,12H2/b14-10-.
What are the key properties of 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol?
4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol has a molecular weight of 249.30 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-thiazol-4-yl)ethanehydrazonoyl]benzene-1,3-diol is sourced from PubChem (CID 135842497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).