C19H15N5OS — CID 135842913
[4-(2-hydroxyphenyl)-6-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3,5-triazin-2-yl]cyanamide (PubChem CID 135842913) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is [4-(2-hydroxyphenyl)-6-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3,5-triazin-2-yl]cyanamide.
| Compound Name | [4-(2-hydroxyphenyl)-6-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3,5-triazin-2-yl]cyanamide |
|---|---|
| PubChem CID | 135842913 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [4-(2-hydroxyphenyl)-6-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3,5-triazin-2-yl]cyanamide |
| SMILES | CSc1ccc(/C=C/c2nc(NC#N)nc(-c3ccccc3O)n2)cc1 |
| InChI | InChI=1S/C19H15N5OS/c1-26-14-9-6-13(7-10-14)8-11-17-22-18(24-19(23-17)21-12-20)15-4-2-3-5-16(15)25/h2-11,25H,1H3,(H,21,22,23,24)/b11-8+ |
| InChIKey | HZHCUBYMZMLBKR-DHZHZOJOSA-N |
| XLogP | 4.03 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|