C24H34N11O8P — CID 135843118
2-amino-9-[5-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-(butylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 135843118) has the molecular formula C24H34N11O8P and a molecular weight of 635.58 g/mol. Its IUPAC name is 2-amino-9-[5-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-(butylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[5-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-(butylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135843118 |
| Molecular Formula | C24H34N11O8P |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | 2-amino-9-[5-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-(butylamino)phosphoryl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | CCCCNP(=O)(OCC1OC(n2cnc3c(=O)[nH]c(N)nc32)CC1O)OC1CC(n2cnc3c(N)ncnc32)OC1CO |
| InChI | InChI=1S/C24H34N11O8P/c1-2-3-4-31-44(39,43-13-6-17(41-14(13)7-36)34-10-29-18-20(25)27-9-28-21(18)34)40-8-15-12(37)5-16(42-15)35-11-30-19-22(35)32-24(26)33-23(19)38/h9-17,36-37H,2-8H2,1H3,(H,31,39)(H2,25,27,28)(H3,26,32,33,38) |
| InChIKey | UZKMYKRGVGYNQA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 265.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|