C18H20Cl2N4O — CID 135843764
N-butyl-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135843764) has the molecular formula C18H20Cl2N4O and a molecular weight of 379.29 g/mol. Its IUPAC name is N-butyl-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-butyl-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135843764 |
| Molecular Formula | C18H20Cl2N4O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-butyl-7-(3,4-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCNC(=O)C1=C(C)Nc2ccnn2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N4O/c1-3-4-8-21-18(25)16-11(2)23-15-7-9-22-24(15)17(16)12-5-6-13(19)14(20)10-12/h5-7,9-10,17,23H,3-4,8H2,1-2H3,(H,21,25) |
| InChIKey | IAMJBNTYLSQYCP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|