C19H22Cl2N4O — CID 135843919
7-(3,4-dichlorophenyl)-5-methyl-N-pentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135843919) has the molecular formula C19H22Cl2N4O and a molecular weight of 393.32 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-5-methyl-N-pentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dichlorophenyl)-5-methyl-N-pentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135843919 |
| Molecular Formula | C19H22Cl2N4O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-5-methyl-N-pentyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCNC(=O)C1=C(C)Nc2ccnn2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N4O/c1-3-4-5-9-22-19(26)17-12(2)24-16-8-10-23-25(16)18(17)13-6-7-14(20)15(21)11-13/h6-8,10-11,18,24H,3-5,9H2,1-2H3,(H,22,26) |
| InChIKey | ZHCFAJLRTANAHT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|