C24H15Cl2F3N2O2S — CID 135844247
(5Z)-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-[4-chloro-2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 135844247) has the molecular formula C24H15Cl2F3N2O2S and a molecular weight of 523.36 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-[4-chloro-2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-[4-chloro-2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135844247 |
| Molecular Formula | C24H15Cl2F3N2O2S |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | (5Z)-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-[4-chloro-2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2C(F)(F)F)S/C1=C\c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H15Cl2F3N2O2S/c25-16-7-10-20(18(12-16)24(27,28)29)30-23-31-22(32)21(34-23)11-14-5-8-17(9-6-14)33-13-15-3-1-2-4-19(15)26/h1-12H,13H2,(H,30,31,32)/b21-11- |
| InChIKey | BTFFOKOLHGYVGV-NHDPSOOVSA-N |
| XLogP | 7.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|