C21H11ClF3N3O4S — CID 135844560
(5E)-2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135844560) has the molecular formula C21H11ClF3N3O4S and a molecular weight of 493.85 g/mol. Its IUPAC name is (5E)-2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135844560 |
| Molecular Formula | C21H11ClF3N3O4S |
| Molecular Weight | 493.85 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | (5E)-2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)c(C(F)(F)F)c2)S/C1=C/c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C21H11ClF3N3O4S/c22-16-7-3-12(9-15(16)21(23,24)25)26-20-27-19(29)18(33-20)10-14-6-8-17(32-14)11-1-4-13(5-2-11)28(30)31/h1-10H,(H,26,27,29)/b18-10+ |
| InChIKey | CZCBALUQONWMSM-VCHYOVAHSA-N |
| XLogP | 6.42 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.85 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|