C19H13NO6 — CID 135844959
16-hydroxy-7,17-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),9,11,14,16,18-octaen-13-one (PubChem CID 135844959) has the molecular formula C19H13NO6 and a molecular weight of 351.31 g/mol. Its IUPAC name is 16-hydroxy-7,17-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),9,11,14,16,18-octaen-13-one.
| Compound Name | 16-hydroxy-7,17-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),9,11,14,16,18-octaen-13-one |
|---|---|
| PubChem CID | 135844959 |
| Molecular Formula | C19H13NO6 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 16-hydroxy-7,17-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),9,11,14,16,18-octaen-13-one |
| SMILES | COc1cc2c(cc1O)C(=O)c1nccc3c(OC)c4c(c-2c13)OCO4 |
| InChI | InChI=1S/C19H13NO6/c1-23-12-6-9-10(5-11(12)21)16(22)15-13-8(3-4-20-15)17(24-2)19-18(14(9)13)25-7-26-19/h3-6,21H,7H2,1-2H3 |
| InChIKey | WQASXWBMZSTCJF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |