C17H16N4O3S — CID 135847353
(2E,5S)-2-[(Z)-[(6S)-6-methylcyclohexa-2,4-dien-1-ylidene]hydrazinylidene]-5-[(2-nitrophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135847353) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is (2E,5S)-2-[(Z)-[(6S)-6-methylcyclohexa-2,4-dien-1-ylidene]hydrazinylidene]-5-[(2-nitrophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-2-[(Z)-[(6S)-6-methylcyclohexa-2,4-dien-1-ylidene]hydrazinylidene]-5-[(2-nitrophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135847353 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (2E,5S)-2-[(Z)-[(6S)-6-methylcyclohexa-2,4-dien-1-ylidene]hydrazinylidene]-5-[(2-nitrophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | C[C@H]1C=CC=C/C1=N/N=C1\NC(=O)[C@H](Cc2ccccc2[N+](=O)[O-])S1 |
| InChI | InChI=1S/C17H16N4O3S/c1-11-6-2-4-8-13(11)19-20-17-18-16(22)15(25-17)10-12-7-3-5-9-14(12)21(23)24/h2-9,11,15H,10H2,1H3,(H,18,20,22)/b19-13-/t11-,15-/m0/s1 |
| InChIKey | HERJUVLXJVPJKB-SQXCRBAJSA-N |
| XLogP | 2.84 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|