C23H20N6O — CID 135847861
6-methyl-3-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135847861) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-methyl-3-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135847861 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-methyl-3-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(N/N=C\c2ccc(N(c3ccccc3)c3ccccc3)cc2)[nH]c1=O |
| InChI | InChI=1S/C23H20N6O/c1-17-22(30)25-23(28-26-17)27-24-16-18-12-14-21(15-13-18)29(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-16H,1H3,(H2,25,27,28,30)/b24-16- |
| InChIKey | AWFYEDRTWTWGHB-JLPGSUDCSA-N |
| XLogP | 4.39 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|