C39H35N3O3S — CID 135848152
2-[(E)-2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium;4-methylbenzenesulfonate (PubChem CID 135848152) has the molecular formula C39H35N3O3S and a molecular weight of 625.79 g/mol. Its IUPAC name is 2-[(E)-2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium;4-methylbenzenesulfonate.
| Compound Name | 2-[(E)-2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135848152 |
| Molecular Formula | C39H35N3O3S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | 2-[(E)-2-(1,2-diphenylindol-3-yl)ethenyl]-1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium;4-methylbenzenesulfonate |
| SMILES | C[N+]1=C(/C=C/c2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)C(C)(C)c2cccnc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C32H28N3.C7H8O3S/c1-32(2)27-18-12-22-33-31(27)34(3)29(32)21-20-26-25-17-10-11-19-28(25)35(24-15-8-5-9-16-24)30(26)23-13-6-4-7-14-23;1-6-2-4-7(5-3-6)11(8,9)10/h4-22H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | RHYBTAZGAJJDLU-UHFFFAOYSA-M |
| XLogP | 8.31 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|