C36H34N4O3S — CID 135848166
4-methylbenzenesulfonate;3-[2-phenyl-3-[(E)-2-(1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium-2-yl)ethenyl]indol-1-yl]propanenitrile (PubChem CID 135848166) has the molecular formula C36H34N4O3S and a molecular weight of 602.76 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-[2-phenyl-3-[(E)-2-(1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium-2-yl)ethenyl]indol-1-yl]propanenitrile.
| Compound Name | 4-methylbenzenesulfonate;3-[2-phenyl-3-[(E)-2-(1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium-2-yl)ethenyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 135848166 |
| Molecular Formula | C36H34N4O3S |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 4-methylbenzenesulfonate;3-[2-phenyl-3-[(E)-2-(1,3,3-trimethylpyrrolo[2,3-b]pyridin-1-ium-2-yl)ethenyl]indol-1-yl]propanenitrile |
| SMILES | C[N+]1=C(/C=C/c2c(-c3ccccc3)n(CCC#N)c3ccccc23)C(C)(C)c2cccnc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C29H27N4.C7H8O3S/c1-29(2)24-14-9-19-31-28(24)32(3)26(29)17-16-23-22-13-7-8-15-25(22)33(20-10-18-30)27(23)21-11-5-4-6-12-21;1-6-2-4-7(5-3-6)11(8,9)10/h4-9,11-17,19H,10,20H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | PBBNOYLMQQNWNI-UHFFFAOYSA-M |
| XLogP | 7.24 |
| TPSA | 101.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|