About 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one
2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one (PubChem CID 135848332) has the molecular formula C6H7N5OS
and a molecular weight of 197.22 g/mol. Its IUPAC name is 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one |
| PubChem CID | 135848332 |
| Molecular Formula | C6H7N5OS |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one |
| SMILES | Cn1c(=S)[nH]c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C6H7N5OS/c1-11-2-3(9-6(11)13)8-5(7)10-4(2)12/h1H3,(H4,7,8,9,10,12,13) |
| InChIKey | ZEWZKTQQADEFHC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one?
The IUPAC name of 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one (CID 135848332) is 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one.
What is the SMILES notation for 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one?
The canonical SMILES for 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one is Cn1c(=S)[nH]c2nc(N)[nH]c(=O)c21.
What is the InChIKey of 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one?
The InChIKey is ZEWZKTQQADEFHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5OS/c1-11-2-3(9-6(11)13)8-5(7)10-4(2)12/h1H3,(H4,7,8,9,10,12,13).
What are the key properties of 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one?
2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one has a molecular weight of 197.22 g/mol, XLogP of -0.10, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-methyl-8-sulfanylidene-1,9-dihydropurin-6-one is sourced from PubChem (CID 135848332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).