About 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one
3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one (PubChem CID 135848430) has the molecular formula C9H7ClN2O2
and a molecular weight of 210.62 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one |
| PubChem CID | 135848430 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one |
| SMILES | O=C1CON=C(c2ccccc2Cl)N1 |
| InChI | InChI=1S/C9H7ClN2O2/c10-7-4-2-1-3-6(7)9-11-8(13)5-14-12-9/h1-4H,5H2,(H,11,12,13) |
| InChIKey | AFJNGQIMPNNVCL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one?
The IUPAC name of 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one (CID 135848430) is 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one.
What is the SMILES notation for 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one?
The canonical SMILES for 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one is O=C1CON=C(c2ccccc2Cl)N1.
What is the InChIKey of 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one?
The InChIKey is AFJNGQIMPNNVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2/c10-7-4-2-1-3-6(7)9-11-8(13)5-14-12-9/h1-4H,5H2,(H,11,12,13).
What are the key properties of 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one?
3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one has a molecular weight of 210.62 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-4H-1,2,4-oxadiazin-5-one is sourced from PubChem (CID 135848430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).