C15H17N5O4 — CID 135849413
2-methoxyethyl (7S)-7-(4-hydroxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135849413) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-methoxyethyl (7S)-7-(4-hydroxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl (7S)-7-(4-hydroxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135849413 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-methoxyethyl (7S)-7-(4-hydroxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)Nc2nnnn2[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C15H17N5O4/c1-9-12(14(22)24-8-7-23-2)13(10-3-5-11(21)6-4-10)20-15(16-9)17-18-19-20/h3-6,13,21H,7-8H2,1-2H3,(H,16,17,19)/t13-/m0/s1 |
| InChIKey | JZIWYWYSWIWCLF-ZDUSSCGKSA-N |
| XLogP | 0.86 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|