C8H12N6O3S3 — CID 135849573
4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,2,5-thiadiazol-3-one (PubChem CID 135849573) has the molecular formula C8H12N6O3S3 and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,2,5-thiadiazol-3-one.
| Compound Name | 4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,2,5-thiadiazol-3-one |
|---|---|
| PubChem CID | 135849573 |
| Molecular Formula | C8H12N6O3S3 |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,2,5-thiadiazol-3-one |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N\CCSCc1ns[nH]c1=O |
| InChI | InChI=1S/C8H12N6O3S3/c1-9-6-7(14-20(16,17)13-6)10-2-3-18-4-5-8(15)12-19-11-5/h2-4H2,1H3,(H,9,13)(H,10,14)(H,12,15) |
| InChIKey | LLRAHDNJFAUXIG-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|