About (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate
(6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate (PubChem CID 135850158) has the molecular formula C16H10Br2N2O5
and a molecular weight of 470.07 g/mol. Its IUPAC name is (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate.
Molecular Properties
| Compound Name | (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate |
| PubChem CID | 135850158 |
| Molecular Formula | C16H10Br2N2O5 |
| Molecular Weight | 470.07 g/mol |
| Exact Mass | 467.90 |
| IUPAC Name | (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate |
| SMILES | O=C(OCc1nc2c(Br)cc(Br)cc2c(=O)[nH]1)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H10Br2N2O5/c17-7-3-10-14(11(18)4-7)19-13(20-15(10)23)6-25-16(24)9-2-1-8(21)5-12(9)22/h1-5,21-22H,6H2,(H,19,20,23) |
| InChIKey | XPKJWGFNGQTXAL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.07 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate?
The IUPAC name of (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate (CID 135850158) is (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate.
What is the SMILES notation for (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate?
The canonical SMILES for (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate is O=C(OCc1nc2c(Br)cc(Br)cc2c(=O)[nH]1)c1ccc(O)cc1O.
What is the InChIKey of (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate?
The InChIKey is XPKJWGFNGQTXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Br2N2O5/c17-7-3-10-14(11(18)4-7)19-13(20-15(10)23)6-25-16(24)9-2-1-8(21)5-12(9)22/h1-5,21-22H,6H2,(H,19,20,23).
What are the key properties of (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate?
(6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate has a molecular weight of 470.07 g/mol, XLogP of 3.22, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6,8-dibromo-4-oxo-3H-quinazolin-2-yl)methyl 2,4-dihydroxybenzoate is sourced from PubChem (CID 135850158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).