C15H12N4O4S — CID 135850163
(2E,5S)-2-(furan-2-ylmethylidenehydrazinylidene)-5-[(3-nitrophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135850163) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is (2E,5S)-2-(furan-2-ylmethylidenehydrazinylidene)-5-[(3-nitrophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-2-(furan-2-ylmethylidenehydrazinylidene)-5-[(3-nitrophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135850163 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (2E,5S)-2-(furan-2-ylmethylidenehydrazinylidene)-5-[(3-nitrophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=Cc2ccco2)S[C@H]1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N4O4S/c20-14-13(8-10-3-1-4-11(7-10)19(21)22)24-15(17-14)18-16-9-12-5-2-6-23-12/h1-7,9,13H,8H2,(H,17,18,20)/t13-/m0/s1 |
| InChIKey | ZZLUSLRYGSCJKP-ZDUSSCGKSA-N |
| XLogP | 2.35 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|