About 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene
2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene (PubChem CID 135850253) has the molecular formula C15H20S2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene |
| PubChem CID | 135850253 |
| Molecular Formula | C15H20S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene |
| SMILES | C1=CC(SCCCCCSC2=CCC=C2)C=C1 |
| InChI | InChI=1S/C15H20S2/c1(6-12-16-14-8-2-3-9-14)7-13-17-15-10-4-5-11-15/h2-4,8-11,14H,1,5-7,12-13H2 |
| InChIKey | UKQCQBBDQTUOQJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene?
The IUPAC name of 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene (CID 135850253) is 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene.
What is the SMILES notation for 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene?
The canonical SMILES for 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene is C1=CC(SCCCCCSC2=CCC=C2)C=C1.
What is the InChIKey of 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene?
The InChIKey is UKQCQBBDQTUOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20S2/c1(6-12-16-14-8-2-3-9-14)7-13-17-15-10-4-5-11-15/h2-4,8-11,14H,1,5-7,12-13H2.
What are the key properties of 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene?
2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene has a molecular weight of 264.46 g/mol, XLogP of 4.96, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopenta-2,4-dien-1-ylsulfanylpentylsulfanyl)cyclopenta-1,3-diene is sourced from PubChem (CID 135850253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).