C23H3F15 — CID 135850259
1,2,3,4,5-pentafluoro-6-[5-(2,3,4,5,6-pentafluorocyclohexa-2,5-dien-1-ylidene)-4-(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,3-dien-1-yl]benzene (PubChem CID 135850259) has the molecular formula C23H3F15 and a molecular weight of 564.25 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[5-(2,3,4,5,6-pentafluorocyclohexa-2,5-dien-1-ylidene)-4-(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,3-dien-1-yl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[5-(2,3,4,5,6-pentafluorocyclohexa-2,5-dien-1-ylidene)-4-(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,3-dien-1-yl]benzene |
|---|---|
| PubChem CID | 135850259 |
| Molecular Formula | C23H3F15 |
| Molecular Weight | 564.25 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[5-(2,3,4,5,6-pentafluorocyclohexa-2,5-dien-1-ylidene)-4-(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,3-dien-1-yl]benzene |
| SMILES | FC1=C(F)C(F)C(F)=C(F)C1=C1C(c2c(F)c(F)c(F)c(F)c2F)=CC=C1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H3F15/c24-9-6(10(25)16(31)21(36)15(9)30)3-1-2-4(7-11(26)17(32)22(37)18(33)12(7)27)5(3)8-13(28)19(34)23(38)20(35)14(8)29/h1-2,23H |
| InChIKey | BDZXYUFYBZWLOY-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.25 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|