C13H14N6O3 — CID 135850808
N-[3-[[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]methyl]-1H-1,2,4-triazol-5-yl]nitramide (PubChem CID 135850808) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is N-[3-[[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]methyl]-1H-1,2,4-triazol-5-yl]nitramide.
| Compound Name | N-[3-[[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]methyl]-1H-1,2,4-triazol-5-yl]nitramide |
|---|---|
| PubChem CID | 135850808 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[3-[[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]methyl]-1H-1,2,4-triazol-5-yl]nitramide |
| SMILES | O=C1C[C@H](c2ccccc2)CN1Cc1n[nH]c(N[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H14N6O3/c20-12-6-10(9-4-2-1-3-5-9)7-18(12)8-11-14-13(16-15-11)17-19(21)22/h1-5,10H,6-8H2,(H2,14,15,16,17)/t10-/m0/s1 |
| InChIKey | ZBIIZGLJBRDXNQ-JTQLQIEISA-N |
| XLogP | 0.92 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|