About 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one
9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one (PubChem CID 135851161) has the molecular formula C7H8N4OS
and a molecular weight of 196.23 g/mol. Its IUPAC name is 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one |
| PubChem CID | 135851161 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one |
| SMILES | CCn1c(=S)[nH]c2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C7H8N4OS/c1-2-11-5-4(10-7(11)13)6(12)9-3-8-5/h3H,2H2,1H3,(H,10,13)(H,8,9,12) |
| InChIKey | QRYRYCNAVUBRCN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one?
The IUPAC name of 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one (CID 135851161) is 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one.
What is the SMILES notation for 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one?
The canonical SMILES for 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one is CCn1c(=S)[nH]c2c(=O)[nH]cnc21.
What is the InChIKey of 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one?
The InChIKey is QRYRYCNAVUBRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c1-2-11-5-4(10-7(11)13)6(12)9-3-8-5/h3H,2H2,1H3,(H,10,13)(H,8,9,12).
What are the key properties of 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one?
9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one has a molecular weight of 196.23 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-8-sulfanylidene-1,7-dihydropurin-6-one is sourced from PubChem (CID 135851161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).