C8H10F3N5O — CID 135851201
7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 135851201) has the molecular formula C8H10F3N5O and a molecular weight of 249.20 g/mol. Its IUPAC name is 7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | 7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 135851201 |
| Molecular Formula | C8H10F3N5O |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | NNC(=O)c1cc2n(n1)C(C(F)(F)F)CCN2 |
| InChI | InChI=1S/C8H10F3N5O/c9-8(10,11)5-1-2-13-6-3-4(7(17)14-12)15-16(5)6/h3,5,13H,1-2,12H2,(H,14,17) |
| InChIKey | UKFWUSWHUAMCLL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|