C15H13N3O6 — CID 135852510
4-hydroxy-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzamide (PubChem CID 135852510) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is 4-hydroxy-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-hydroxy-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135852510 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-hydroxy-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(O)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H13N3O6/c1-24-13-7-9(6-12(14(13)20)18(22)23)8-16-17-15(21)10-2-4-11(19)5-3-10/h2-8,19-20H,1H3,(H,17,21)/b16-8+ |
| InChIKey | SVYGYDAZFLNVDH-LZYBPNLTSA-N |
| XLogP | 1.78 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|