C18H11ClN6O4S — CID 135853261
6-(4-chlorophenyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one (PubChem CID 135853261) has the molecular formula C18H11ClN6O4S and a molecular weight of 442.84 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one.
| Compound Name | 6-(4-chlorophenyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 135853261 |
| Molecular Formula | C18H11ClN6O4S |
| Molecular Weight | 442.84 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 6-(4-chlorophenyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
| SMILES | O=C(CSc1nnc2[nH]c(=O)c(-c3ccc(Cl)cc3)nn12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H11ClN6O4S/c19-12-5-1-11(2-6-12)15-16(27)20-17-21-22-18(24(17)23-15)30-9-14(26)10-3-7-13(8-4-10)25(28)29/h1-8H,9H2,(H,20,21,27) |
| InChIKey | VHXIVAOPSVCVGU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|