C19H26N4O3 — CID 135853285
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 135853285) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 135853285 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2c(O)nc3ccccn3c2=O)C1 |
| InChI | InChI=1S/C19H26N4O3/c1-13-10-14(2)12-22(11-13)8-5-7-20-17(24)16-18(25)21-15-6-3-4-9-23(15)19(16)26/h3-4,6,9,13-14,25H,5,7-8,10-12H2,1-2H3,(H,20,24) |
| InChIKey | LCOUKSZPXQEMLP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|