About 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol
3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol (PubChem CID 135855839) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol.
Molecular Properties
| Compound Name | 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol |
| PubChem CID | 135855839 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol |
| SMILES | Oc1ccc2c(c1)CCc1c(-c3ccccc3O)noc1-2 |
| InChI | InChI=1S/C17H13NO3/c19-11-6-8-12-10(9-11)5-7-14-16(18-21-17(12)14)13-3-1-2-4-15(13)20/h1-4,6,8-9,19-20H,5,7H2 |
| InChIKey | PRYITBYNIVJDKN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol?
The IUPAC name of 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol (CID 135855839) is 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol.
What is the SMILES notation for 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol?
The canonical SMILES for 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol is Oc1ccc2c(c1)CCc1c(-c3ccccc3O)noc1-2.
What is the InChIKey of 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol?
The InChIKey is PRYITBYNIVJDKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c19-11-6-8-12-10(9-11)5-7-14-16(18-21-17(12)14)13-3-1-2-4-15(13)20/h1-4,6,8-9,19-20H,5,7H2.
What are the key properties of 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol?
3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol has a molecular weight of 279.30 g/mol, XLogP of 3.52, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyphenyl)-4,5-dihydrobenzo[g][1,2]benzoxazol-7-ol is sourced from PubChem (CID 135855839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).