About 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one
2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135856559) has the molecular formula C12H10N4OS3
and a molecular weight of 322.44 g/mol. Its IUPAC name is 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one |
| PubChem CID | 135856559 |
| Molecular Formula | C12H10N4OS3 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | CSc1nsc(C(S)c2nc3ccccc3c(=O)[nH]2)n1 |
| InChI | InChI=1S/C12H10N4OS3/c1-19-12-15-11(20-16-12)8(18)9-13-7-5-3-2-4-6(7)10(17)14-9/h2-5,8,18H,1H3,(H,13,14,17) |
| InChIKey | JEJCOFXFDVLLSC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one?
The IUPAC name of 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one (CID 135856559) is 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one.
What is the SMILES notation for 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one?
The canonical SMILES for 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one is CSc1nsc(C(S)c2nc3ccccc3c(=O)[nH]2)n1.
What is the InChIKey of 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one?
The InChIKey is JEJCOFXFDVLLSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4OS3/c1-19-12-15-11(20-16-12)8(18)9-13-7-5-3-2-4-6(7)10(17)14-9/h2-5,8,18H,1H3,(H,13,14,17).
What are the key properties of 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one?
2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one has a molecular weight of 322.44 g/mol, XLogP of 2.52, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-sulfanylmethyl]-3H-quinazolin-4-one is sourced from PubChem (CID 135856559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).